C13H15ClN4O2 — CID 62081674
4-amino-N-(2-chloro-5-methoxyphenyl)-5-ethyl-1H-pyrazole-3-carboxamide (PubChem CID 62081674) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 4-amino-N-(2-chloro-5-methoxyphenyl)-5-ethyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-N-(2-chloro-5-methoxyphenyl)-5-ethyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 62081674 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-amino-N-(2-chloro-5-methoxyphenyl)-5-ethyl-1H-pyrazole-3-carboxamide |
| SMILES | CCc1[nH]nc(C(=O)Nc2cc(OC)ccc2Cl)c1N |
| InChI | InChI=1S/C13H15ClN4O2/c1-3-9-11(15)12(18-17-9)13(19)16-10-6-7(20-2)4-5-8(10)14/h4-6H,3,15H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | YXXKGMDOOZCIFJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |