C22H27NO3 — CID 10760540
N-tert-butyl-2-hydroxy-2-methyl-5,5-diphenyloxolane-3-carboxamide (PubChem CID 10760540) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is N-tert-butyl-2-hydroxy-2-methyl-5,5-diphenyloxolane-3-carboxamide.
| Compound Name | N-tert-butyl-2-hydroxy-2-methyl-5,5-diphenyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 10760540 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-tert-butyl-2-hydroxy-2-methyl-5,5-diphenyloxolane-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CC(c2ccccc2)(c2ccccc2)OC1(C)O |
| InChI | InChI=1S/C22H27NO3/c1-20(2,3)23-19(24)18-15-22(26-21(18,4)25,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14,18,25H,15H2,1-4H3,(H,23,24) |
| InChIKey | BIRFQYMGIKIQQN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |