C28H36N2O5 — CID 10790892
2-hydroxy-2-methyl-N-[6-(3-oxobutanoylamino)hexyl]-5,5-diphenyloxolane-3-carboxamide (PubChem CID 10790892) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N-[6-(3-oxobutanoylamino)hexyl]-5,5-diphenyloxolane-3-carboxamide.
| Compound Name | 2-hydroxy-2-methyl-N-[6-(3-oxobutanoylamino)hexyl]-5,5-diphenyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 10790892 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 2-hydroxy-2-methyl-N-[6-(3-oxobutanoylamino)hexyl]-5,5-diphenyloxolane-3-carboxamide |
| SMILES | CC(=O)CC(=O)NCCCCCCNC(=O)C1CC(c2ccccc2)(c2ccccc2)OC1(C)O |
| InChI | InChI=1S/C28H36N2O5/c1-21(31)19-25(32)29-17-11-3-4-12-18-30-26(33)24-20-28(35-27(24,2)34,22-13-7-5-8-14-22)23-15-9-6-10-16-23/h5-10,13-16,24,34H,3-4,11-12,17-20H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | YJPFLQMTVLSZBI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|