C13H11ClIN3O — CID 107606088
2-amino-N-(2-chloro-4-iodophenyl)-6-methylpyridine-4-carboxamide (PubChem CID 107606088) has the molecular formula C13H11ClIN3O and a molecular weight of 387.61 g/mol. Its IUPAC name is 2-amino-N-(2-chloro-4-iodophenyl)-6-methylpyridine-4-carboxamide.
| Compound Name | 2-amino-N-(2-chloro-4-iodophenyl)-6-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 107606088 |
| Molecular Formula | C13H11ClIN3O |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | 2-amino-N-(2-chloro-4-iodophenyl)-6-methylpyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(I)cc2Cl)cc(N)n1 |
| InChI | InChI=1S/C13H11ClIN3O/c1-7-4-8(5-12(16)17-7)13(19)18-11-3-2-9(15)6-10(11)14/h2-6H,1H3,(H2,16,17)(H,18,19) |
| InChIKey | VOYSKYJFFJSWPY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|