About 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide
3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide (PubChem CID 107607002) has the molecular formula C11H15ClIN3O
and a molecular weight of 367.62 g/mol. Its IUPAC name is 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide.
Molecular Properties
| Compound Name | 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide |
| PubChem CID | 107607002 |
| Molecular Formula | C11H15ClIN3O |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide |
| SMILES | CCC(C/C(N)=N/O)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C11H15ClIN3O/c1-2-8(6-11(14)16-17)15-10-4-3-7(13)5-9(10)12/h3-5,8,15,17H,2,6H2,1H3,(H2,14,16) |
| InChIKey | MOPLVGKHQAFRGI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide?
The IUPAC name of 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide (CID 107607002) is 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide.
What is the SMILES notation for 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide?
The canonical SMILES for 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide is CCC(C/C(N)=N/O)Nc1ccc(I)cc1Cl.
What is the InChIKey of 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide?
The InChIKey is MOPLVGKHQAFRGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClIN3O/c1-2-8(6-11(14)16-17)15-10-4-3-7(13)5-9(10)12/h3-5,8,15,17H,2,6H2,1H3,(H2,14,16).
What are the key properties of 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide?
3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide has a molecular weight of 367.62 g/mol, XLogP of 3.27, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-4-iodoanilino)-N'-hydroxypentanimidamide is sourced from PubChem (CID 107607002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).