C11H15Br2N3O — CID 77032771
3-(2,5-dibromoanilino)-N'-hydroxypentanimidamide (PubChem CID 77032771) has the molecular formula C11H15Br2N3O and a molecular weight of 365.07 g/mol. Its IUPAC name is 3-(2,5-dibromoanilino)-N'-hydroxypentanimidamide.
| Compound Name | 3-(2,5-dibromoanilino)-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 77032771 |
| Molecular Formula | C11H15Br2N3O |
| Molecular Weight | 365.07 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | 3-(2,5-dibromoanilino)-N'-hydroxypentanimidamide |
| SMILES | CCC(CC(N)=NO)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H15Br2N3O/c1-2-8(6-11(14)16-17)15-10-5-7(12)3-4-9(10)13/h3-5,8,15,17H,2,6H2,1H3,(H2,14,16) |
| InChIKey | HHKGLPXEACBHJP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.07 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|