C10H14BrN3O — CID 77026721
3-(2-bromoanilino)-N'-hydroxybutanimidamide (PubChem CID 77026721) has the molecular formula C10H14BrN3O and a molecular weight of 272.15 g/mol. Its IUPAC name is 3-(2-bromoanilino)-N'-hydroxybutanimidamide.
| Compound Name | 3-(2-bromoanilino)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 77026721 |
| Molecular Formula | C10H14BrN3O |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 3-(2-bromoanilino)-N'-hydroxybutanimidamide |
| SMILES | CC(CC(N)=NO)Nc1ccccc1Br |
| InChI | InChI=1S/C10H14BrN3O/c1-7(6-10(12)14-15)13-9-5-3-2-4-8(9)11/h2-5,7,13,15H,6H2,1H3,(H2,12,14) |
| InChIKey | ZKHPDJXFFDRCSL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|