C11H15BrClN3O — CID 104724441
3-(2-bromo-5-chloro-4-methylanilino)-N'-hydroxybutanimidamide (PubChem CID 104724441) has the molecular formula C11H15BrClN3O and a molecular weight of 320.62 g/mol. Its IUPAC name is 3-(2-bromo-5-chloro-4-methylanilino)-N'-hydroxybutanimidamide.
| Compound Name | 3-(2-bromo-5-chloro-4-methylanilino)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 104724441 |
| Molecular Formula | C11H15BrClN3O |
| Molecular Weight | 320.62 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 3-(2-bromo-5-chloro-4-methylanilino)-N'-hydroxybutanimidamide |
| SMILES | Cc1cc(Br)c(NC(C)C/C(N)=N/O)cc1Cl |
| InChI | InChI=1S/C11H15BrClN3O/c1-6-3-8(12)10(5-9(6)13)15-7(2)4-11(14)16-17/h3,5,7,15,17H,4H2,1-2H3,(H2,14,16) |
| InChIKey | MRUOLXRUGOXNPF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|