C10H13BrClN3O — CID 103480356
3-(2-bromo-3-chloroanilino)-N'-hydroxybutanimidamide (PubChem CID 103480356) has the molecular formula C10H13BrClN3O and a molecular weight of 306.59 g/mol. Its IUPAC name is 3-(2-bromo-3-chloroanilino)-N'-hydroxybutanimidamide.
| Compound Name | 3-(2-bromo-3-chloroanilino)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 103480356 |
| Molecular Formula | C10H13BrClN3O |
| Molecular Weight | 306.59 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 3-(2-bromo-3-chloroanilino)-N'-hydroxybutanimidamide |
| SMILES | CC(C/C(N)=N/O)Nc1cccc(Cl)c1Br |
| InChI | InChI=1S/C10H13BrClN3O/c1-6(5-9(13)15-16)14-8-4-2-3-7(12)10(8)11/h2-4,6,14,16H,5H2,1H3,(H2,13,15) |
| InChIKey | ZQRHGCFYHUSPLI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|