C12H12ClIN2 — CID 107608062
8-chloro-6-iodo-N-propylquinolin-2-amine (PubChem CID 107608062) has the molecular formula C12H12ClIN2 and a molecular weight of 346.60 g/mol. Its IUPAC name is 8-chloro-6-iodo-N-propylquinolin-2-amine.
| Compound Name | 8-chloro-6-iodo-N-propylquinolin-2-amine |
|---|---|
| PubChem CID | 107608062 |
| Molecular Formula | C12H12ClIN2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 8-chloro-6-iodo-N-propylquinolin-2-amine |
| SMILES | CCCNc1ccc2cc(I)cc(Cl)c2n1 |
| InChI | InChI=1S/C12H12ClIN2/c1-2-5-15-11-4-3-8-6-9(14)7-10(13)12(8)16-11/h3-4,6-7H,2,5H2,1H3,(H,15,16) |
| InChIKey | KXQWWIFDJFQTON-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|