C13H13BrF2N2O2 — CID 107608195
1-(4-bromo-2,5-difluorophenyl)-6-propan-2-ylpiperazine-2,5-dione (PubChem CID 107608195) has the molecular formula C13H13BrF2N2O2 and a molecular weight of 347.16 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-6-propan-2-ylpiperazine-2,5-dione.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-6-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107608195 |
| Molecular Formula | C13H13BrF2N2O2 |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-6-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)C1C(=O)NCC(=O)N1c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C13H13BrF2N2O2/c1-6(2)12-13(20)17-5-11(19)18(12)10-4-8(15)7(14)3-9(10)16/h3-4,6,12H,5H2,1-2H3,(H,17,20) |
| InChIKey | MWSBDUUZUKFJRP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|