C9H8BrFN2O — CID 162753594
7-bromo-6-fluoro-1-methyl-3,4-dihydroquinoxalin-2-one (PubChem CID 162753594) has the molecular formula C9H8BrFN2O and a molecular weight of 259.08 g/mol. Its IUPAC name is 7-bromo-6-fluoro-1-methyl-3,4-dihydroquinoxalin-2-one.
| Compound Name | 7-bromo-6-fluoro-1-methyl-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 162753594 |
| Molecular Formula | C9H8BrFN2O |
| Molecular Weight | 259.08 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 7-bromo-6-fluoro-1-methyl-3,4-dihydroquinoxalin-2-one |
| SMILES | CN1C(=O)CNc2cc(F)c(Br)cc21 |
| InChI | InChI=1S/C9H8BrFN2O/c1-13-8-2-5(10)6(11)3-7(8)12-4-9(13)14/h2-3,12H,4H2,1H3 |
| InChIKey | AIQDMBXZVBYSEU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.08 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |