C9H11N3O — CID 28693613
6-amino-1-methyl-3,4-dihydroquinoxalin-2-one (PubChem CID 28693613) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 6-amino-1-methyl-3,4-dihydroquinoxalin-2-one.
| Compound Name | 6-amino-1-methyl-3,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 28693613 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 6-amino-1-methyl-3,4-dihydroquinoxalin-2-one |
| SMILES | CN1C(=O)CNc2cc(N)ccc21 |
| InChI | InChI=1S/C9H11N3O/c1-12-8-3-2-6(10)4-7(8)11-5-9(12)13/h2-4,11H,5,10H2,1H3 |
| InChIKey | SYSWWERZKFTJJQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|