C15H13IN2O — CID 3042981
5-cyclopenta-2,4-dien-1-ylidene-7-iodo-1-methyl-3,4-dihydro-1,4-benzodiazepin-2-one (PubChem CID 3042981) has the molecular formula C15H13IN2O and a molecular weight of 364.19 g/mol. Its IUPAC name is 5-cyclopenta-2,4-dien-1-ylidene-7-iodo-1-methyl-3,4-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 5-cyclopenta-2,4-dien-1-ylidene-7-iodo-1-methyl-3,4-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 3042981 |
| Molecular Formula | C15H13IN2O |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 5-cyclopenta-2,4-dien-1-ylidene-7-iodo-1-methyl-3,4-dihydro-1,4-benzodiazepin-2-one |
| SMILES | CN1C(=O)CNC(=C2C=CC=C2)c2cc(I)ccc21 |
| InChI | InChI=1S/C15H13IN2O/c1-18-13-7-6-11(16)8-12(13)15(17-9-14(18)19)10-4-2-3-5-10/h2-8,17H,9H2,1H3 |
| InChIKey | RVWYQAKZBIULMY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|