C16H15IN4O3 — CID 71098940
5-(2,4-dimethoxypyrimidin-5-yl)-7-iodo-1-methyl-3H-1,4-benzodiazepin-2-one (PubChem CID 71098940) has the molecular formula C16H15IN4O3 and a molecular weight of 438.23 g/mol. Its IUPAC name is 5-(2,4-dimethoxypyrimidin-5-yl)-7-iodo-1-methyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 5-(2,4-dimethoxypyrimidin-5-yl)-7-iodo-1-methyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 71098940 |
| Molecular Formula | C16H15IN4O3 |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 5-(2,4-dimethoxypyrimidin-5-yl)-7-iodo-1-methyl-3H-1,4-benzodiazepin-2-one |
| SMILES | COc1ncc(C2=NCC(=O)N(C)c3ccc(I)cc32)c(OC)n1 |
| InChI | InChI=1S/C16H15IN4O3/c1-21-12-5-4-9(17)6-10(12)14(18-8-13(21)22)11-7-19-16(24-3)20-15(11)23-2/h4-7H,8H2,1-3H3 |
| InChIKey | MXFZUAOFGIURSL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|