C19H21N3O3 — CID 143748256
6-amino-1-methyl-3,4-dihydroquinolin-2-one;6-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 143748256) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 6-amino-1-methyl-3,4-dihydroquinolin-2-one;6-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-1-methyl-3,4-dihydroquinolin-2-one;6-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 143748256 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 6-amino-1-methyl-3,4-dihydroquinolin-2-one;6-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)CCc2cc(N)ccc21.Cc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C10H12N2O.C9H9NO2/c1-12-9-4-3-8(11)6-7(9)2-5-10(12)13;1-6-2-3-8-7(4-6)10-9(11)5-12-8/h3-4,6H,2,5,11H2,1H3;2-4H,5H2,1H3,(H,10,11) |
| InChIKey | WEXKECIGIMPNDW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|