About 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one
1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one (PubChem CID 102855679) has the molecular formula C9H7BrF2N2O
and a molecular weight of 277.07 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one |
| PubChem CID | 102855679 |
| Molecular Formula | C9H7BrF2N2O |
| Molecular Weight | 277.07 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one |
| SMILES | O=C1NCCN1c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C9H7BrF2N2O/c10-5-3-8(7(12)4-6(5)11)14-2-1-13-9(14)15/h3-4H,1-2H2,(H,13,15) |
| InChIKey | UPNQDGSYFUOBCW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.07 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one?
The IUPAC name of 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one (CID 102855679) is 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one.
What is the SMILES notation for 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one?
The canonical SMILES for 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one is O=C1NCCN1c1cc(Br)c(F)cc1F.
What is the InChIKey of 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one?
The InChIKey is UPNQDGSYFUOBCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrF2N2O/c10-5-3-8(7(12)4-6(5)11)14-2-1-13-9(14)15/h3-4H,1-2H2,(H,13,15).
What are the key properties of 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one?
1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one has a molecular weight of 277.07 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-2,4-difluorophenyl)imidazolidin-2-one is sourced from PubChem (CID 102855679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).