C11H10BrF2N3 — CID 107608623
N-(4-bromo-2,5-difluorophenyl)-1-ethylimidazol-2-amine (PubChem CID 107608623) has the molecular formula C11H10BrF2N3 and a molecular weight of 302.12 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-1-ethylimidazol-2-amine.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-1-ethylimidazol-2-amine |
|---|---|
| PubChem CID | 107608623 |
| Molecular Formula | C11H10BrF2N3 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-1-ethylimidazol-2-amine |
| SMILES | CCn1ccnc1Nc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C11H10BrF2N3/c1-2-17-4-3-15-11(17)16-10-6-8(13)7(12)5-9(10)14/h3-6H,2H2,1H3,(H,15,16) |
| InChIKey | DMIYIYRTGIPTBE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|