C12H10F3N3 — CID 106570738
1-prop-2-enyl-N-(2,4,5-trifluorophenyl)imidazol-2-amine (PubChem CID 106570738) has the molecular formula C12H10F3N3 and a molecular weight of 253.23 g/mol. Its IUPAC name is 1-prop-2-enyl-N-(2,4,5-trifluorophenyl)imidazol-2-amine.
| Compound Name | 1-prop-2-enyl-N-(2,4,5-trifluorophenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106570738 |
| Molecular Formula | C12H10F3N3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 1-prop-2-enyl-N-(2,4,5-trifluorophenyl)imidazol-2-amine |
| SMILES | C=CCn1ccnc1Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H10F3N3/c1-2-4-18-5-3-16-12(18)17-11-7-9(14)8(13)6-10(11)15/h2-3,5-7H,1,4H2,(H,16,17) |
| InChIKey | IAHTZOOFNDQUGP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|