C11H15N5 — CID 106583191
1,3-dimethyl-N-(1-prop-2-enylimidazol-2-yl)pyrazol-4-amine (PubChem CID 106583191) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 1,3-dimethyl-N-(1-prop-2-enylimidazol-2-yl)pyrazol-4-amine.
| Compound Name | 1,3-dimethyl-N-(1-prop-2-enylimidazol-2-yl)pyrazol-4-amine |
|---|---|
| PubChem CID | 106583191 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1,3-dimethyl-N-(1-prop-2-enylimidazol-2-yl)pyrazol-4-amine |
| SMILES | C=CCn1ccnc1Nc1cn(C)nc1C |
| InChI | InChI=1S/C11H15N5/c1-4-6-16-7-5-12-11(16)13-10-8-15(3)14-9(10)2/h4-5,7-8H,1,6H2,2-3H3,(H,12,13) |
| InChIKey | NITQUFZDWIPFDR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|