C12H11Br2N3 — CID 107605118
N-(2,6-dibromophenyl)-1-prop-2-enylimidazol-2-amine (PubChem CID 107605118) has the molecular formula C12H11Br2N3 and a molecular weight of 357.05 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)-1-prop-2-enylimidazol-2-amine.
| Compound Name | N-(2,6-dibromophenyl)-1-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 107605118 |
| Molecular Formula | C12H11Br2N3 |
| Molecular Weight | 357.05 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | N-(2,6-dibromophenyl)-1-prop-2-enylimidazol-2-amine |
| SMILES | C=CCn1ccnc1Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C12H11Br2N3/c1-2-7-17-8-6-15-12(17)16-11-9(13)4-3-5-10(11)14/h2-6,8H,1,7H2,(H,15,16) |
| InChIKey | GUFMOHJISSTCQV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.05 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|