C14H15Br2N3 — CID 107605114
1-cyclopentyl-N-(2,6-dibromophenyl)imidazol-2-amine (PubChem CID 107605114) has the molecular formula C14H15Br2N3 and a molecular weight of 385.10 g/mol. Its IUPAC name is 1-cyclopentyl-N-(2,6-dibromophenyl)imidazol-2-amine.
| Compound Name | 1-cyclopentyl-N-(2,6-dibromophenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 107605114 |
| Molecular Formula | C14H15Br2N3 |
| Molecular Weight | 385.10 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 1-cyclopentyl-N-(2,6-dibromophenyl)imidazol-2-amine |
| SMILES | Brc1cccc(Br)c1Nc1nccn1C1CCCC1 |
| InChI | InChI=1S/C14H15Br2N3/c15-11-6-3-7-12(16)13(11)18-14-17-8-9-19(14)10-4-1-2-5-10/h3,6-10H,1-2,4-5H2,(H,17,18) |
| InChIKey | WRWFONAJHSXJCB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.10 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |