C14H14BrCl2N3 — CID 107795932
N-(4-bromo-2,3-dichlorophenyl)-1-cyclopentylimidazol-2-amine (PubChem CID 107795932) has the molecular formula C14H14BrCl2N3 and a molecular weight of 375.10 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-1-cyclopentylimidazol-2-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-1-cyclopentylimidazol-2-amine |
|---|---|
| PubChem CID | 107795932 |
| Molecular Formula | C14H14BrCl2N3 |
| Molecular Weight | 375.10 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-1-cyclopentylimidazol-2-amine |
| SMILES | Clc1c(Br)ccc(Nc2nccn2C2CCCC2)c1Cl |
| InChI | InChI=1S/C14H14BrCl2N3/c15-10-5-6-11(13(17)12(10)16)19-14-18-7-8-20(14)9-3-1-2-4-9/h5-9H,1-4H2,(H,18,19) |
| InChIKey | PPYMHPUFBOSZFW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.10 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|