C16H16BrF2N — CID 107609450
4-bromo-N-[1-(3,5-dimethylphenyl)ethyl]-2,5-difluoroaniline (PubChem CID 107609450) has the molecular formula C16H16BrF2N and a molecular weight of 340.21 g/mol. Its IUPAC name is 4-bromo-N-[1-(3,5-dimethylphenyl)ethyl]-2,5-difluoroaniline.
| Compound Name | 4-bromo-N-[1-(3,5-dimethylphenyl)ethyl]-2,5-difluoroaniline |
|---|---|
| PubChem CID | 107609450 |
| Molecular Formula | C16H16BrF2N |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 4-bromo-N-[1-(3,5-dimethylphenyl)ethyl]-2,5-difluoroaniline |
| SMILES | Cc1cc(C)cc(C(C)Nc2cc(F)c(Br)cc2F)c1 |
| InChI | InChI=1S/C16H16BrF2N/c1-9-4-10(2)6-12(5-9)11(3)20-16-8-14(18)13(17)7-15(16)19/h4-8,11,20H,1-3H3 |
| InChIKey | XWQCGGQPCMBYLF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|