C14H19BrClFN2O2 — CID 107610574
tert-butyl N-[3-(2-bromo-6-chloro-4-fluoroanilino)propyl]carbamate (PubChem CID 107610574) has the molecular formula C14H19BrClFN2O2 and a molecular weight of 381.67 g/mol. Its IUPAC name is tert-butyl N-[3-(2-bromo-6-chloro-4-fluoroanilino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-bromo-6-chloro-4-fluoroanilino)propyl]carbamate |
|---|---|
| PubChem CID | 107610574 |
| Molecular Formula | C14H19BrClFN2O2 |
| Molecular Weight | 381.67 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | tert-butyl N-[3-(2-bromo-6-chloro-4-fluoroanilino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1c(Cl)cc(F)cc1Br |
| InChI | InChI=1S/C14H19BrClFN2O2/c1-14(2,3)21-13(20)19-6-4-5-18-12-10(15)7-9(17)8-11(12)16/h7-8,18H,4-6H2,1-3H3,(H,19,20) |
| InChIKey | HUBIHWSVSVYARD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.67 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|