C16H14BrF2N — CID 107610897
4-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-2,5-difluoroaniline (PubChem CID 107610897) has the molecular formula C16H14BrF2N and a molecular weight of 338.20 g/mol. Its IUPAC name is 4-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-2,5-difluoroaniline.
| Compound Name | 4-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-2,5-difluoroaniline |
|---|---|
| PubChem CID | 107610897 |
| Molecular Formula | C16H14BrF2N |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 4-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-2,5-difluoroaniline |
| SMILES | Fc1cc(NCc2ccc3c(c2)CCC3)c(F)cc1Br |
| InChI | InChI=1S/C16H14BrF2N/c17-13-7-15(19)16(8-14(13)18)20-9-10-4-5-11-2-1-3-12(11)6-10/h4-8,20H,1-3,9H2 |
| InChIKey | YFLOOEXDTIQGMQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|