C17H21F3O3S — CID 10761132
ethyl 2-[(4-butylsulfanylphenyl)methyl]-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 10761132) has the molecular formula C17H21F3O3S and a molecular weight of 362.41 g/mol. Its IUPAC name is ethyl 2-[(4-butylsulfanylphenyl)methyl]-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | ethyl 2-[(4-butylsulfanylphenyl)methyl]-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 10761132 |
| Molecular Formula | C17H21F3O3S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | ethyl 2-[(4-butylsulfanylphenyl)methyl]-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CCCCSc1ccc(CC(C(=O)OCC)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H21F3O3S/c1-3-5-10-24-13-8-6-12(7-9-13)11-14(16(22)23-4-2)15(21)17(18,19)20/h6-9,14H,3-5,10-11H2,1-2H3 |
| InChIKey | UXZYBNRCEUGJIP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|