C22H34O4 — CID 10761161
[(1S,4aS,5R,5'R,6S,8aS)-5'-ethenyl-1,4a,5',6-tetramethyl-8-oxospiro[2,3,4,6,7,8a-hexahydronaphthalene-5,2'-oxolane]-1-yl]methyl acetate (PubChem CID 10761161) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(1S,4aS,5R,5'R,6S,8aS)-5'-ethenyl-1,4a,5',6-tetramethyl-8-oxospiro[2,3,4,6,7,8a-hexahydronaphthalene-5,2'-oxolane]-1-yl]methyl acetate.
| Compound Name | [(1S,4aS,5R,5'R,6S,8aS)-5'-ethenyl-1,4a,5',6-tetramethyl-8-oxospiro[2,3,4,6,7,8a-hexahydronaphthalene-5,2'-oxolane]-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10761161 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(1S,4aS,5R,5'R,6S,8aS)-5'-ethenyl-1,4a,5',6-tetramethyl-8-oxospiro[2,3,4,6,7,8a-hexahydronaphthalene-5,2'-oxolane]-1-yl]methyl acetate |
| SMILES | C=C[C@@]1(C)CC[C@@]2(O1)[C@@H](C)CC(=O)[C@H]1[C@@](C)(COC(C)=O)CCC[C@@]12C |
| InChI | InChI=1S/C22H34O4/c1-7-20(5)11-12-22(26-20)15(2)13-17(24)18-19(4,14-25-16(3)23)9-8-10-21(18,22)6/h7,15,18H,1,8-14H2,2-6H3/t15-,18-,19+,20-,21-,22+/m0/s1 |
| InChIKey | IQUPRCLIVNZVGQ-XEEILAJESA-N |
| XLogP | 4.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|