C12H15BrClN3O2 — CID 107615226
N-(4-bromo-3-chlorophenyl)-2-[(Z)-N'-hydroxycarbamimidoyl]-3-methylbutanamide (PubChem CID 107615226) has the molecular formula C12H15BrClN3O2 and a molecular weight of 348.63 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)-2-[(Z)-N'-hydroxycarbamimidoyl]-3-methylbutanamide.
| Compound Name | N-(4-bromo-3-chlorophenyl)-2-[(Z)-N'-hydroxycarbamimidoyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 107615226 |
| Molecular Formula | C12H15BrClN3O2 |
| Molecular Weight | 348.63 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)-2-[(Z)-N'-hydroxycarbamimidoyl]-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)Nc1ccc(Br)c(Cl)c1)/C(N)=N/O |
| InChI | InChI=1S/C12H15BrClN3O2/c1-6(2)10(11(15)17-19)12(18)16-7-3-4-8(13)9(14)5-7/h3-6,10,19H,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | RPGLNYQRFFOVMQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.63 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|