C13H15BrClNO3 — CID 107615349
2-[(4-bromo-3-chlorophenyl)carbamoyl]-3,3-dimethylbutanoic acid (PubChem CID 107615349) has the molecular formula C13H15BrClNO3 and a molecular weight of 348.62 g/mol. Its IUPAC name is 2-[(4-bromo-3-chlorophenyl)carbamoyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(4-bromo-3-chlorophenyl)carbamoyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 107615349 |
| Molecular Formula | C13H15BrClNO3 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 2-[(4-bromo-3-chlorophenyl)carbamoyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)C(=O)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C13H15BrClNO3/c1-13(2,3)10(12(18)19)11(17)16-7-4-5-8(14)9(15)6-7/h4-6,10H,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | KETYYWGIGSIGNQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|