C14H19NO4 — CID 116537436
2-[[4-(hydroxymethyl)phenyl]carbamoyl]-3,3-dimethylbutanoic acid (PubChem CID 116537436) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-[[4-(hydroxymethyl)phenyl]carbamoyl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[[4-(hydroxymethyl)phenyl]carbamoyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 116537436 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-[[4-(hydroxymethyl)phenyl]carbamoyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C14H19NO4/c1-14(2,3)11(13(18)19)12(17)15-10-6-4-9(8-16)5-7-10/h4-7,11,16H,8H2,1-3H3,(H,15,17)(H,18,19) |
| InChIKey | VVSLUYJYBNZBHM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|