C22H30N2O2 — CID 102226044
1-(3,5-ditert-butylphenyl)-3-[4-(hydroxymethyl)phenyl]urea (PubChem CID 102226044) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-(3,5-ditert-butylphenyl)-3-[4-(hydroxymethyl)phenyl]urea.
| Compound Name | 1-(3,5-ditert-butylphenyl)-3-[4-(hydroxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 102226044 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1-(3,5-ditert-butylphenyl)-3-[4-(hydroxymethyl)phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(CO)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H30N2O2/c1-21(2,3)16-11-17(22(4,5)6)13-19(12-16)24-20(26)23-18-9-7-15(14-25)8-10-18/h7-13,25H,14H2,1-6H3,(H2,23,24,26) |
| InChIKey | APFMUNZOTXASGQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |