C27H41N3O2 — CID 132515421
1-(3,5-ditert-butylphenyl)-3-[4-[(5-hydroxypentylamino)methyl]phenyl]urea (PubChem CID 132515421) has the molecular formula C27H41N3O2 and a molecular weight of 439.64 g/mol. Its IUPAC name is 1-(3,5-ditert-butylphenyl)-3-[4-[(5-hydroxypentylamino)methyl]phenyl]urea.
| Compound Name | 1-(3,5-ditert-butylphenyl)-3-[4-[(5-hydroxypentylamino)methyl]phenyl]urea |
|---|---|
| PubChem CID | 132515421 |
| Molecular Formula | C27H41N3O2 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.32 |
| IUPAC Name | 1-(3,5-ditert-butylphenyl)-3-[4-[(5-hydroxypentylamino)methyl]phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(CNCCCCCO)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H41N3O2/c1-26(2,3)21-16-22(27(4,5)6)18-24(17-21)30-25(32)29-23-12-10-20(11-13-23)19-28-14-8-7-9-15-31/h10-13,16-18,28,31H,7-9,14-15,19H2,1-6H3,(H2,29,30,32) |
| InChIKey | CTXMMOXJUZLCMN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|