C26H28Cl2N4O2 — CID 3600875
1-[5-tert-butyl-3-[(4-chlorophenyl)carbamoylamino]-2-ethylphenyl]-3-(4-chlorophenyl)urea (PubChem CID 3600875) has the molecular formula C26H28Cl2N4O2 and a molecular weight of 499.44 g/mol. Its IUPAC name is 1-[5-tert-butyl-3-[(4-chlorophenyl)carbamoylamino]-2-ethylphenyl]-3-(4-chlorophenyl)urea.
| Compound Name | 1-[5-tert-butyl-3-[(4-chlorophenyl)carbamoylamino]-2-ethylphenyl]-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 3600875 |
| Molecular Formula | C26H28Cl2N4O2 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 1-[5-tert-butyl-3-[(4-chlorophenyl)carbamoylamino]-2-ethylphenyl]-3-(4-chlorophenyl)urea |
| SMILES | CCc1c(NC(=O)Nc2ccc(Cl)cc2)cc(C(C)(C)C)cc1NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H28Cl2N4O2/c1-5-21-22(31-24(33)29-19-10-6-17(27)7-11-19)14-16(26(2,3)4)15-23(21)32-25(34)30-20-12-8-18(28)9-13-20/h6-15H,5H2,1-4H3,(H2,29,31,33)(H2,30,32,34) |
| InChIKey | AGZQQDXTSGWZED-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |