C17H25NO3 — CID 157369639
(2R,5S)-N-[4-(hydroxymethyl)phenyl]-2,5,6-trimethyl-4-oxoheptanamide (PubChem CID 157369639) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (2R,5S)-N-[4-(hydroxymethyl)phenyl]-2,5,6-trimethyl-4-oxoheptanamide.
| Compound Name | (2R,5S)-N-[4-(hydroxymethyl)phenyl]-2,5,6-trimethyl-4-oxoheptanamide |
|---|---|
| PubChem CID | 157369639 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (2R,5S)-N-[4-(hydroxymethyl)phenyl]-2,5,6-trimethyl-4-oxoheptanamide |
| SMILES | CC(C)[C@H](C)C(=O)C[C@@H](C)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-11(2)13(4)16(20)9-12(3)17(21)18-15-7-5-14(10-19)6-8-15/h5-8,11-13,19H,9-10H2,1-4H3,(H,18,21)/t12-,13+/m1/s1 |
| InChIKey | ZGVSQBQTABBBPL-OLZOCXBDSA-N |
| XLogP | 3.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |