C17H23NO3 — CID 120690043
3-[4-(2,4-dimethylpent-4-enoylamino)phenyl]-2-methylpropanoic acid (PubChem CID 120690043) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-[4-(2,4-dimethylpent-4-enoylamino)phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[4-(2,4-dimethylpent-4-enoylamino)phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120690043 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-[4-(2,4-dimethylpent-4-enoylamino)phenyl]-2-methylpropanoic acid |
| SMILES | C=C(C)CC(C)C(=O)Nc1ccc(CC(C)C(=O)O)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-11(2)9-12(3)16(19)18-15-7-5-14(6-8-15)10-13(4)17(20)21/h5-8,12-13H,1,9-10H2,2-4H3,(H,18,19)(H,20,21) |
| InChIKey | UQNSYLJTWLZLFG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|