C17H22N2O4 — CID 120687097
2-[[2-[4-(2,4-dimethylpent-4-enoylamino)phenyl]acetyl]amino]acetic acid (PubChem CID 120687097) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-[[2-[4-(2,4-dimethylpent-4-enoylamino)phenyl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-(2,4-dimethylpent-4-enoylamino)phenyl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 120687097 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-[[2-[4-(2,4-dimethylpent-4-enoylamino)phenyl]acetyl]amino]acetic acid |
| SMILES | C=C(C)CC(C)C(=O)Nc1ccc(CC(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C17H22N2O4/c1-11(2)8-12(3)17(23)19-14-6-4-13(5-7-14)9-15(20)18-10-16(21)22/h4-7,12H,1,8-10H2,2-3H3,(H,18,20)(H,19,23)(H,21,22) |
| InChIKey | GWJPVIPNANPJQP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|