C20H27N3O5 — CID 119224629
2-[[2-[4-[3-(cyclopentanecarbonylamino)butanoylamino]phenyl]acetyl]amino]acetic acid (PubChem CID 119224629) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-[[2-[4-[3-(cyclopentanecarbonylamino)butanoylamino]phenyl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-[3-(cyclopentanecarbonylamino)butanoylamino]phenyl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 119224629 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[[2-[4-[3-(cyclopentanecarbonylamino)butanoylamino]phenyl]acetyl]amino]acetic acid |
| SMILES | CC(CC(=O)Nc1ccc(CC(=O)NCC(=O)O)cc1)NC(=O)C1CCCC1 |
| InChI | InChI=1S/C20H27N3O5/c1-13(22-20(28)15-4-2-3-5-15)10-18(25)23-16-8-6-14(7-9-16)11-17(24)21-12-19(26)27/h6-9,13,15H,2-5,10-12H2,1H3,(H,21,24)(H,22,28)(H,23,25)(H,26,27) |
| InChIKey | NRSFFWBWXDIKGQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |