C18H23N3O5 — CID 119224615
2-[[2-[4-[4-(cyclopropanecarbonylamino)butanoylamino]phenyl]acetyl]amino]acetic acid (PubChem CID 119224615) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-[[2-[4-[4-(cyclopropanecarbonylamino)butanoylamino]phenyl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[4-[4-(cyclopropanecarbonylamino)butanoylamino]phenyl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 119224615 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-[[2-[4-[4-(cyclopropanecarbonylamino)butanoylamino]phenyl]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)Cc1ccc(NC(=O)CCCNC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C18H23N3O5/c22-15(2-1-9-19-18(26)13-5-6-13)21-14-7-3-12(4-8-14)10-16(23)20-11-17(24)25/h3-4,7-8,13H,1-2,5-6,9-11H2,(H,19,26)(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | ZWHKWXIKKNWYCT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|