About N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide
N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 107615426) has the molecular formula C12H10BrClN4O
and a molecular weight of 341.60 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide |
| PubChem CID | 107615426 |
| Molecular Formula | C12H10BrClN4O |
| Molecular Weight | 341.60 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)c(Cl)c1)c1n[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C12H10BrClN4O/c13-8-4-3-7(5-9(8)14)15-12(19)11-16-10(17-18-11)6-1-2-6/h3-6H,1-2H2,(H,15,19)(H,16,17,18) |
| InChIKey | LUFPAGWRUDPSIE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide?
The IUPAC name of N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide (CID 107615426) is N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide?
The canonical SMILES for N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide is O=C(Nc1ccc(Br)c(Cl)c1)c1n[nH]c(C2CC2)n1.
What is the InChIKey of N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide?
The InChIKey is LUFPAGWRUDPSIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrClN4O/c13-8-4-3-7(5-9(8)14)15-12(19)11-16-10(17-18-11)6-1-2-6/h3-6H,1-2H2,(H,15,19)(H,16,17,18).
What are the key properties of N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide?
N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide has a molecular weight of 341.60 g/mol, XLogP of 3.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-3-chlorophenyl)-5-cyclopropyl-1H-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 107615426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).