C16H12F2N2 — CID 107615849
2,5-difluoro-4-(quinolin-4-ylmethyl)aniline (PubChem CID 107615849) has the molecular formula C16H12F2N2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2,5-difluoro-4-(quinolin-4-ylmethyl)aniline.
| Compound Name | 2,5-difluoro-4-(quinolin-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 107615849 |
| Molecular Formula | C16H12F2N2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2,5-difluoro-4-(quinolin-4-ylmethyl)aniline |
| SMILES | Nc1cc(F)c(Cc2ccnc3ccccc23)cc1F |
| InChI | InChI=1S/C16H12F2N2/c17-13-9-15(19)14(18)8-11(13)7-10-5-6-20-16-4-2-1-3-12(10)16/h1-6,8-9H,7,19H2 |
| InChIKey | QREZXZUVIDCRCZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|