C16H11F3N2 — CID 63868241
3,4,5-trifluoro-N-(quinolin-4-ylmethyl)aniline (PubChem CID 63868241) has the molecular formula C16H11F3N2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-(quinolin-4-ylmethyl)aniline.
| Compound Name | 3,4,5-trifluoro-N-(quinolin-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 63868241 |
| Molecular Formula | C16H11F3N2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3,4,5-trifluoro-N-(quinolin-4-ylmethyl)aniline |
| SMILES | Fc1cc(NCc2ccnc3ccccc23)cc(F)c1F |
| InChI | InChI=1S/C16H11F3N2/c17-13-7-11(8-14(18)16(13)19)21-9-10-5-6-20-15-4-2-1-3-12(10)15/h1-8,21H,9H2 |
| InChIKey | YTOXVDAPZKZXBQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|