C17H16ClN3 — CID 107616169
3-chloro-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)aniline (PubChem CID 107616169) has the molecular formula C17H16ClN3 and a molecular weight of 297.79 g/mol. Its IUPAC name is 3-chloro-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)aniline.
| Compound Name | 3-chloro-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)aniline |
|---|---|
| PubChem CID | 107616169 |
| Molecular Formula | C17H16ClN3 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-chloro-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)aniline |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1-c1ccc(N)cc1Cl |
| InChI | InChI=1S/C17H16ClN3/c1-11-17(15-9-8-13(19)10-16(15)18)12(2)21(20-11)14-6-4-3-5-7-14/h3-10H,19H2,1-2H3 |
| InChIKey | GABBORXSMOFVGZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|