C13H14ClN3O3 — CID 107622126
1-(4-chloro-3-methoxyphenyl)-5-propan-2-yltriazole-4-carboxylic acid (PubChem CID 107622126) has the molecular formula C13H14ClN3O3 and a molecular weight of 295.73 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-5-propan-2-yltriazole-4-carboxylic acid.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-5-propan-2-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107622126 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-5-propan-2-yltriazole-4-carboxylic acid |
| SMILES | COc1cc(-n2nnc(C(=O)O)c2C(C)C)ccc1Cl |
| InChI | InChI=1S/C13H14ClN3O3/c1-7(2)12-11(13(18)19)15-16-17(12)8-4-5-9(14)10(6-8)20-3/h4-7H,1-3H3,(H,18,19) |
| InChIKey | UBNUWIHMQBPQNG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |