C8H8ClN5O — CID 107623543
1-(4-chloro-3-methoxyphenyl)tetrazol-5-amine (PubChem CID 107623543) has the molecular formula C8H8ClN5O and a molecular weight of 225.64 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)tetrazol-5-amine.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 107623543 |
| Molecular Formula | C8H8ClN5O |
| Molecular Weight | 225.64 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)tetrazol-5-amine |
| SMILES | COc1cc(-n2nnnc2N)ccc1Cl |
| InChI | InChI=1S/C8H8ClN5O/c1-15-7-4-5(2-3-6(7)9)14-8(10)11-12-13-14/h2-4H,1H3,(H2,10,11,13) |
| InChIKey | BRBZRDKTCOMNNJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.64 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |