C10H11N5 — CID 79506398
1-(2,3-dihydro-1H-inden-5-yl)tetrazol-5-amine (PubChem CID 79506398) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)tetrazol-5-amine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)tetrazol-5-amine |
|---|---|
| PubChem CID | 79506398 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)tetrazol-5-amine |
| SMILES | Nc1nnnn1-c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C10H11N5/c11-10-12-13-14-15(10)9-5-4-7-2-1-3-8(7)6-9/h4-6H,1-3H2,(H2,11,12,14) |
| InChIKey | KFSVAKBNWOHCSK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |