C14H17ClN2OS — CID 107622755
5-[(4-chloro-3-methoxyphenyl)methyl]-4-propyl-1,3-thiazol-2-amine (PubChem CID 107622755) has the molecular formula C14H17ClN2OS and a molecular weight of 296.82 g/mol. Its IUPAC name is 5-[(4-chloro-3-methoxyphenyl)methyl]-4-propyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(4-chloro-3-methoxyphenyl)methyl]-4-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107622755 |
| Molecular Formula | C14H17ClN2OS |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-[(4-chloro-3-methoxyphenyl)methyl]-4-propyl-1,3-thiazol-2-amine |
| SMILES | CCCc1nc(N)sc1Cc1ccc(Cl)c(OC)c1 |
| InChI | InChI=1S/C14H17ClN2OS/c1-3-4-11-13(19-14(16)17-11)8-9-5-6-10(15)12(7-9)18-2/h5-7H,3-4,8H2,1-2H3,(H2,16,17) |
| InChIKey | ZPFSIQDTEFBVMV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |