C13H13F3N2S — CID 62813752
4-propyl-5-[(3,4,5-trifluorophenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 62813752) has the molecular formula C13H13F3N2S and a molecular weight of 286.32 g/mol. Its IUPAC name is 4-propyl-5-[(3,4,5-trifluorophenyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-propyl-5-[(3,4,5-trifluorophenyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62813752 |
| Molecular Formula | C13H13F3N2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-propyl-5-[(3,4,5-trifluorophenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | CCCc1nc(N)sc1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H13F3N2S/c1-2-3-10-11(19-13(17)18-10)6-7-4-8(14)12(16)9(15)5-7/h4-5H,2-3,6H2,1H3,(H2,17,18) |
| InChIKey | FOVANIDVJVTQQL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|