C12H9F5N2S — CID 115564802
4-ethyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 115564802) has the molecular formula C12H9F5N2S and a molecular weight of 308.28 g/mol. Its IUPAC name is 4-ethyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115564802 |
| Molecular Formula | C12H9F5N2S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 4-ethyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | CCc1nc(N)sc1Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H9F5N2S/c1-2-5-6(20-12(18)19-5)3-4-7(13)9(15)11(17)10(16)8(4)14/h2-3H2,1H3,(H2,18,19) |
| InChIKey | BCUFUGPLOWZCQH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|