C13H14F2N2S — CID 62065021
5-[(2,6-difluorophenyl)methyl]-4-propyl-1,3-thiazol-2-amine (PubChem CID 62065021) has the molecular formula C13H14F2N2S and a molecular weight of 268.33 g/mol. Its IUPAC name is 5-[(2,6-difluorophenyl)methyl]-4-propyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(2,6-difluorophenyl)methyl]-4-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62065021 |
| Molecular Formula | C13H14F2N2S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5-[(2,6-difluorophenyl)methyl]-4-propyl-1,3-thiazol-2-amine |
| SMILES | CCCc1nc(N)sc1Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H14F2N2S/c1-2-4-11-12(18-13(16)17-11)7-8-9(14)5-3-6-10(8)15/h3,5-6H,2,4,7H2,1H3,(H2,16,17) |
| InChIKey | HYNTXNQAWWTPDM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |